C22H17NO3 — CID 925737
5-(3,5-dimethylphenoxy)-2-phenylisoindole-1,3-dione (PubChem CID 925737) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 5-(3,5-dimethylphenoxy)-2-phenylisoindole-1,3-dione.
| Compound Name | 5-(3,5-dimethylphenoxy)-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 925737 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 5-(3,5-dimethylphenoxy)-2-phenylisoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(Oc2ccc3c(c2)C(=O)N(c2ccccc2)C3=O)c1 |
| InChI | InChI=1S/C22H17NO3/c1-14-10-15(2)12-18(11-14)26-17-8-9-19-20(13-17)22(25)23(21(19)24)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | XDAJCJFNOOEIQE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|