C40H25N3O6 — CID 123289566
5-[1-imino-3-oxo-2-(4-phenoxyphenyl)isoindol-5-yl]oxy-2-(4-phenoxyphenyl)isoindole-1,3-dione (PubChem CID 123289566) has the molecular formula C40H25N3O6 and a molecular weight of 643.66 g/mol. Its IUPAC name is 5-[1-imino-3-oxo-2-(4-phenoxyphenyl)isoindol-5-yl]oxy-2-(4-phenoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-[1-imino-3-oxo-2-(4-phenoxyphenyl)isoindol-5-yl]oxy-2-(4-phenoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 123289566 |
| Molecular Formula | C40H25N3O6 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | 5-[1-imino-3-oxo-2-(4-phenoxyphenyl)isoindol-5-yl]oxy-2-(4-phenoxyphenyl)isoindole-1,3-dione |
| SMILES | [H]/N=C1\c2ccc(Oc3ccc4c(c3)C(=O)N(c3ccc(Oc5ccccc5)cc3)C4=O)cc2C(=O)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C40H25N3O6/c41-37-33-21-19-31(23-35(33)39(45)42(37)25-11-15-29(16-12-25)47-27-7-3-1-4-8-27)49-32-20-22-34-36(24-32)40(46)43(38(34)44)26-13-17-30(18-14-26)48-28-9-5-2-6-10-28/h1-24,41H/b41-37+ |
| InChIKey | YSIZFVCXFRHXMJ-SWNXMFJWSA-N |
| XLogP | 8.85 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|