C41H26N2O6 — CID 126711406
6-[1,3-dioxo-2-(4-phenoxyphenyl)isoindol-5-yl]-2-(4-phenoxyphenyl)-3H-isoquinoline-1,4-dione (PubChem CID 126711406) has the molecular formula C41H26N2O6 and a molecular weight of 642.67 g/mol. Its IUPAC name is 6-[1,3-dioxo-2-(4-phenoxyphenyl)isoindol-5-yl]-2-(4-phenoxyphenyl)-3H-isoquinoline-1,4-dione.
| Compound Name | 6-[1,3-dioxo-2-(4-phenoxyphenyl)isoindol-5-yl]-2-(4-phenoxyphenyl)-3H-isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 126711406 |
| Molecular Formula | C41H26N2O6 |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 6-[1,3-dioxo-2-(4-phenoxyphenyl)isoindol-5-yl]-2-(4-phenoxyphenyl)-3H-isoquinoline-1,4-dione |
| SMILES | O=C1CN(c2ccc(Oc3ccccc3)cc2)C(=O)c2ccc(-c3ccc4c(c3)C(=O)N(c3ccc(Oc5ccccc5)cc3)C4=O)cc21 |
| InChI | InChI=1S/C41H26N2O6/c44-38-25-42(28-13-17-32(18-14-28)48-30-7-3-1-4-8-30)39(45)34-21-11-26(23-36(34)38)27-12-22-35-37(24-27)41(47)43(40(35)46)29-15-19-33(20-16-29)49-31-9-5-2-6-10-31/h1-24H,25H2 |
| InChIKey | ZEYVEEWSWGLBPE-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|