C38H27NO3P+ — CID 59031820
[4-(1,3-dioxo-5-phenoxyisoindol-2-yl)phenyl]-triphenylphosphanium (PubChem CID 59031820) has the molecular formula C38H27NO3P+ and a molecular weight of 576.61 g/mol. Its IUPAC name is [4-(1,3-dioxo-5-phenoxyisoindol-2-yl)phenyl]-triphenylphosphanium.
| Compound Name | [4-(1,3-dioxo-5-phenoxyisoindol-2-yl)phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 59031820 |
| Molecular Formula | C38H27NO3P+ |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | [4-(1,3-dioxo-5-phenoxyisoindol-2-yl)phenyl]-triphenylphosphanium |
| SMILES | O=C1c2ccc(Oc3ccccc3)cc2C(=O)N1c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H27NO3P/c40-37-35-26-23-30(42-29-13-5-1-6-14-29)27-36(35)38(41)39(37)28-21-24-34(25-22-28)43(31-15-7-2-8-16-31,32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-27H/q+1 |
| InChIKey | VTRIZYUHQUAMPA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|