C28H14N4O9 — CID 3109986
2-(4-nitrophenyl)-5-[2-(4-nitrophenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 3109986) has the molecular formula C28H14N4O9 and a molecular weight of 550.44 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[2-(4-nitrophenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(4-nitrophenyl)-5-[2-(4-nitrophenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 3109986 |
| Molecular Formula | C28H14N4O9 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[2-(4-nitrophenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc4c(c3)C(=O)N(c3ccc([N+](=O)[O-])cc3)C4=O)cc2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H14N4O9/c33-25-21-11-9-19(13-23(21)27(35)29(25)15-1-5-17(6-2-15)31(37)38)41-20-10-12-22-24(14-20)28(36)30(26(22)34)16-3-7-18(8-4-16)32(39)40/h1-14H |
| InChIKey | VQQONKSLROYGOZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 170.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|