C40H22N4O12S — CID 3108370
5-nitro-2-[4-[4-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione (PubChem CID 3108370) has the molecular formula C40H22N4O12S and a molecular weight of 782.70 g/mol. Its IUPAC name is 5-nitro-2-[4-[4-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[4-[4-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3108370 |
| Molecular Formula | C40H22N4O12S |
| Molecular Weight | 782.70 g/mol |
| Exact Mass | 782.10 |
| IUPAC Name | 5-nitro-2-[4-[4-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1c1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N5C(=O)c6ccc([N+](=O)[O-])cc6C5=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H22N4O12S/c45-37-33-19-5-25(43(49)50)21-35(33)39(47)41(37)23-1-7-27(8-2-23)55-29-11-15-31(16-12-29)57(53,54)32-17-13-30(14-18-32)56-28-9-3-24(4-10-28)42-38(46)34-20-6-26(44(51)52)22-36(34)40(42)48/h1-22H |
| InChIKey | VONLGGQFKGDCCA-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 213.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|