C21H14N2O5 — CID 1115477
2-(4-methylphenyl)-5-(3-nitrophenoxy)isoindole-1,3-dione (PubChem CID 1115477) has the molecular formula C21H14N2O5 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-(3-nitrophenoxy)isoindole-1,3-dione.
| Compound Name | 2-(4-methylphenyl)-5-(3-nitrophenoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 1115477 |
| Molecular Formula | C21H14N2O5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(4-methylphenyl)-5-(3-nitrophenoxy)isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H14N2O5/c1-13-5-7-14(8-6-13)22-20(24)18-10-9-17(12-19(18)21(22)25)28-16-4-2-3-15(11-16)23(26)27/h2-12H,1H3 |
| InChIKey | XWWZMPNSQHOSQP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|