C15H10N2O5 — CID 68976074
5-methoxy-2-(4-nitrophenyl)isoindole-1,3-dione (PubChem CID 68976074) has the molecular formula C15H10N2O5 and a molecular weight of 298.25 g/mol. Its IUPAC name is 5-methoxy-2-(4-nitrophenyl)isoindole-1,3-dione.
| Compound Name | 5-methoxy-2-(4-nitrophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 68976074 |
| Molecular Formula | C15H10N2O5 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-methoxy-2-(4-nitrophenyl)isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(c1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C15H10N2O5/c1-22-11-6-7-12-13(8-11)15(19)16(14(12)18)9-2-4-10(5-3-9)17(20)21/h2-8H,1H3 |
| InChIKey | BQXHMXILMHEQEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|