C22H15ClN2O7 — CID 17359549
2-(5-chloro-2,4-dimethoxyphenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione (PubChem CID 17359549) has the molecular formula C22H15ClN2O7 and a molecular weight of 454.82 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyphenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione.
| Compound Name | 2-(5-chloro-2,4-dimethoxyphenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 17359549 |
| Molecular Formula | C22H15ClN2O7 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyphenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione |
| SMILES | COc1cc(OC)c(N2C(=O)c3ccc(Oc4ccc([N+](=O)[O-])cc4)cc3C2=O)cc1Cl |
| InChI | InChI=1S/C22H15ClN2O7/c1-30-19-11-20(31-2)18(10-17(19)23)24-21(26)15-8-7-14(9-16(15)22(24)27)32-13-5-3-12(4-6-13)25(28)29/h3-11H,1-2H3 |
| InChIKey | IFCQLSKZXIXOMB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|