C20H11N3O8 — CID 17296478
2-(2-hydroxy-4-nitrophenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione (PubChem CID 17296478) has the molecular formula C20H11N3O8 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-(2-hydroxy-4-nitrophenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxy-4-nitrophenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 17296478 |
| Molecular Formula | C20H11N3O8 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-(2-hydroxy-4-nitrophenyl)-5-(4-nitrophenoxy)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2C(=O)N1c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C20H11N3O8/c24-18-9-12(23(29)30)3-8-17(18)21-19(25)15-7-6-14(10-16(15)20(21)26)31-13-4-1-11(2-5-13)22(27)28/h1-10,24H |
| InChIKey | CEVMNMNNYCWMIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|