C20H10N3O8- — CID 7034915
4-nitro-2-[5-(3-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenolate (PubChem CID 7034915) has the molecular formula C20H10N3O8- and a molecular weight of 420.31 g/mol. Its IUPAC name is 4-nitro-2-[5-(3-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenolate.
| Compound Name | 4-nitro-2-[5-(3-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenolate |
|---|---|
| PubChem CID | 7034915 |
| Molecular Formula | C20H10N3O8- |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 4-nitro-2-[5-(3-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenolate |
| SMILES | O=C1c2ccc(Oc3cccc([N+](=O)[O-])c3)cc2C(=O)N1c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C20H11N3O8/c24-18-7-4-12(23(29)30)9-17(18)21-19(25)15-6-5-14(10-16(15)20(21)26)31-13-3-1-2-11(8-13)22(27)28/h1-10,24H/p-1 |
| InChIKey | JBBSDZDZQVKLLG-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 155.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|