C28H15N3O7 — CID 1132321
2-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-5-nitroisoindole-1,3-dione (PubChem CID 1132321) has the molecular formula C28H15N3O7 and a molecular weight of 505.44 g/mol. Its IUPAC name is 2-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 1132321 |
| Molecular Formula | C28H15N3O7 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3cccc(N4C(=O)c5ccc([N+](=O)[O-])cc5C4=O)c3)cc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H15N3O7/c32-25-22-12-10-20(15-24(22)28(35)29(25)16-5-2-1-3-6-16)38-19-8-4-7-17(13-19)30-26(33)21-11-9-18(31(36)37)14-23(21)27(30)34/h1-15H |
| InChIKey | MLTVYABHOQKQIQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|