C41H24N4O8 — CID 17018691
5-nitro-2-[4-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]-diphenylmethyl]phenyl]isoindole-1,3-dione (PubChem CID 17018691) has the molecular formula C41H24N4O8 and a molecular weight of 700.66 g/mol. Its IUPAC name is 5-nitro-2-[4-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]-diphenylmethyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[4-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]-diphenylmethyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 17018691 |
| Molecular Formula | C41H24N4O8 |
| Molecular Weight | 700.66 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | 5-nitro-2-[4-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]-diphenylmethyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1c1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C41H24N4O8/c46-37-33-21-19-31(44(50)51)23-35(33)39(48)42(37)29-15-11-27(12-16-29)41(25-7-3-1-4-8-25,26-9-5-2-6-10-26)28-13-17-30(18-14-28)43-38(47)34-22-20-32(45(52)53)24-36(34)40(43)49/h1-24H |
| InChIKey | LEVVVJQFSINOOS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|