C16H12N2O6 — CID 110168012
2-(3,4-dimethoxyphenyl)-5-nitroisoindole-1,3-dione (PubChem CID 110168012) has the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-nitroisoindole-1,3-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 110168012 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1OC |
| InChI | InChI=1S/C16H12N2O6/c1-23-13-6-4-9(8-14(13)24-2)17-15(19)11-5-3-10(18(21)22)7-12(11)16(17)20/h3-8H,1-2H3 |
| InChIKey | CIYHJGCFNXMHCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|