C22H12N3O7- — CID 3351477
2-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate (PubChem CID 3351477) has the molecular formula C22H12N3O7- and a molecular weight of 430.35 g/mol. Its IUPAC name is 2-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate.
| Compound Name | 2-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 3351477 |
| Molecular Formula | C22H12N3O7- |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccc(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C22H13N3O7/c26-19(23-18-4-2-1-3-16(18)22(29)30)12-5-7-13(8-6-12)24-20(27)15-10-9-14(25(31)32)11-17(15)21(24)28/h1-11H,(H,23,26)(H,29,30)/p-1 |
| InChIKey | XWNXMCLAUCXSRM-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|