C21H12FN3O5 — CID 9410846
2-(4-fluorophenyl)-N-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 9410846) has the molecular formula C21H12FN3O5 and a molecular weight of 405.34 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9410846 |
| Molecular Formula | C21H12FN3O5 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H12FN3O5/c22-13-5-7-15(8-6-13)24-20(27)17-9-4-12(10-18(17)21(24)28)19(26)23-14-2-1-3-16(11-14)25(29)30/h1-11H,(H,23,26) |
| InChIKey | CSLDOSYVTOJKRW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|