C19H11N5O5 — CID 3315754
4-(5,7-dioxopyrrolo[3,4-d]pyrimidin-6-yl)-N-(3-nitrophenyl)benzamide (PubChem CID 3315754) has the molecular formula C19H11N5O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is 4-(5,7-dioxopyrrolo[3,4-d]pyrimidin-6-yl)-N-(3-nitrophenyl)benzamide.
| Compound Name | 4-(5,7-dioxopyrrolo[3,4-d]pyrimidin-6-yl)-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 3315754 |
| Molecular Formula | C19H11N5O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-(5,7-dioxopyrrolo[3,4-d]pyrimidin-6-yl)-N-(3-nitrophenyl)benzamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc(N2C(=O)c3cncnc3C2=O)cc1 |
| InChI | InChI=1S/C19H11N5O5/c25-17(22-12-2-1-3-14(8-12)24(28)29)11-4-6-13(7-5-11)23-18(26)15-9-20-10-21-16(15)19(23)27/h1-10H,(H,22,25) |
| InChIKey | GTTRPBTYGMUNCE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|