C27H16N4O7S — CID 3100594
N-(3-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3100594) has the molecular formula C27H16N4O7S and a molecular weight of 540.51 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3100594 |
| Molecular Formula | C27H16N4O7S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | N-(3-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)C(=O)N(c1ccc(Sc3ccc([N+](=O)[O-])cc3)cc1)C2=O |
| InChI | InChI=1S/C27H16N4O7S/c32-25(28-17-2-1-3-20(15-17)31(37)38)16-4-13-23-24(14-16)27(34)29(26(23)33)18-5-9-21(10-6-18)39-22-11-7-19(8-12-22)30(35)36/h1-15H,(H,28,32) |
| InChIKey | PKRJDTVEXGIIIT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|