C33H21N3O5S — CID 3331987
2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxo-N-(2-phenylphenyl)isoindole-5-carboxamide (PubChem CID 3331987) has the molecular formula C33H21N3O5S and a molecular weight of 571.61 g/mol. Its IUPAC name is 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxo-N-(2-phenylphenyl)isoindole-5-carboxamide.
| Compound Name | 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxo-N-(2-phenylphenyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 3331987 |
| Molecular Formula | C33H21N3O5S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxo-N-(2-phenylphenyl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1ccc2c(c1)C(=O)N(c1ccc(Sc3ccc([N+](=O)[O-])cc3)cc1)C2=O |
| InChI | InChI=1S/C33H21N3O5S/c37-31(34-30-9-5-4-8-27(30)21-6-2-1-3-7-21)22-10-19-28-29(20-22)33(39)35(32(28)38)23-11-15-25(16-12-23)42-26-17-13-24(14-18-26)36(40)41/h1-20H,(H,34,37) |
| InChIKey | AUGODBDNAWNIAG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|