C24H14N4O7 — CID 2937315
N-(1,3-dioxo-2-phenylisoindol-4-yl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2937315) has the molecular formula C24H14N4O7 and a molecular weight of 470.40 g/mol. Its IUPAC name is N-(1,3-dioxo-2-phenylisoindol-4-yl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(1,3-dioxo-2-phenylisoindol-4-yl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2937315 |
| Molecular Formula | C24H14N4O7 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-(1,3-dioxo-2-phenylisoindol-4-yl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1cccc2c1C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C24H14N4O7/c29-19(12-26-21(30)15-10-9-14(28(34)35)11-17(15)22(26)31)25-18-8-4-7-16-20(18)24(33)27(23(16)32)13-5-2-1-3-6-13/h1-11H,12H2,(H,25,29) |
| InChIKey | PYYJJKTUXNTHFR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|