C26H19N5O5 — CID 16797171
N-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 16797171) has the molecular formula C26H19N5O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 16797171 |
| Molecular Formula | C26H19N5O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1ccc(-c2cc(NC(=O)CN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H19N5O5/c1-16-7-9-17(10-8-16)22-14-23(30(28-22)18-5-3-2-4-6-18)27-24(32)15-29-25(33)20-12-11-19(31(35)36)13-21(20)26(29)34/h2-14H,15H2,1H3,(H,27,32) |
| InChIKey | PZONFQVLSSHFRI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|