C21H18N4O3 — CID 46583198
2-(1,3-dioxoisoindol-2-yl)-N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]acetamide (PubChem CID 46583198) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 46583198 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]acetamide |
| SMILES | Cc1ccc(-n2nc(C)cc2NC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H18N4O3/c1-13-7-9-15(10-8-13)25-18(11-14(2)23-25)22-19(26)12-24-20(27)16-5-3-4-6-17(16)21(24)28/h3-11H,12H2,1-2H3,(H,22,26) |
| InChIKey | BCDMWEUNXIIFIJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|