C22H14N2O7 — CID 1115457
[4-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenyl] acetate (PubChem CID 1115457) has the molecular formula C22H14N2O7 and a molecular weight of 418.36 g/mol. Its IUPAC name is [4-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenyl] acetate.
| Compound Name | [4-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1115457 |
| Molecular Formula | C22H14N2O7 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [4-[5-(4-nitrophenoxy)-1,3-dioxoisoindol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3ccc(Oc4ccc([N+](=O)[O-])cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H14N2O7/c1-13(25)30-16-6-2-14(3-7-16)23-21(26)19-11-10-18(12-20(19)22(23)27)31-17-8-4-15(5-9-17)24(28)29/h2-12H,1H3 |
| InChIKey | FDTACVKEVCPNFH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|