C42H28N2O9S — CID 67472814
2-methyl-5-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 67472814) has the molecular formula C42H28N2O9S and a molecular weight of 736.76 g/mol. Its IUPAC name is 2-methyl-5-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-methyl-5-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 67472814 |
| Molecular Formula | C42H28N2O9S |
| Molecular Weight | 736.76 g/mol |
| Exact Mass | 736.15 |
| IUPAC Name | 2-methyl-5-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N5C(=O)c6ccc(Oc7ccc8c(c7)C(=O)N(C)C8=O)cc6C5=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H28N2O9S/c1-25-3-7-27(8-4-25)51-29-11-17-33(18-12-29)54(49,50)34-19-13-30(14-20-34)52-28-9-5-26(6-10-28)44-41(47)36-22-16-32(24-38(36)42(44)48)53-31-15-21-35-37(23-31)40(46)43(2)39(35)45/h3-24H,1-2H3 |
| InChIKey | FKLXYQAVKYLWGV-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.76 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|