C22H14NO5- — CID 7046804
4-[5-(4-methylphenoxy)-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 7046804) has the molecular formula C22H14NO5- and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-[5-(4-methylphenoxy)-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | 4-[5-(4-methylphenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 7046804 |
| Molecular Formula | C22H14NO5- |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[5-(4-methylphenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | Cc1ccc(Oc2ccc3c(c2)C(=O)N(c2ccc(C(=O)[O-])cc2)C3=O)cc1 |
| InChI | InChI=1S/C22H15NO5/c1-13-2-8-16(9-3-13)28-17-10-11-18-19(12-17)21(25)23(20(18)24)15-6-4-14(5-7-15)22(26)27/h2-12H,1H3,(H,26,27)/p-1 |
| InChIKey | PAORKHPUYWRMMU-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|