C22H11N2O5- — CID 3651425
2-[4-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3651425) has the molecular formula C22H11N2O5- and a molecular weight of 383.34 g/mol. Its IUPAC name is 2-[4-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-[4-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3651425 |
| Molecular Formula | C22H11N2O5- |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[4-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | N#Cc1ccc(Oc2ccc(N3C(=O)c4ccc(C(=O)[O-])cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C22H12N2O5/c23-12-13-1-6-16(7-2-13)29-17-8-4-15(5-9-17)24-20(25)18-10-3-14(22(27)28)11-19(18)21(24)26/h1-11H,(H,27,28)/p-1 |
| InChIKey | QHLNIASBGTYIHG-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|