C29H15N2O6- — CID 7034711
4-[2-[2-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carbonyl]benzoate (PubChem CID 7034711) has the molecular formula C29H15N2O6- and a molecular weight of 487.45 g/mol. Its IUPAC name is 4-[2-[2-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carbonyl]benzoate.
| Compound Name | 4-[2-[2-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carbonyl]benzoate |
|---|---|
| PubChem CID | 7034711 |
| Molecular Formula | C29H15N2O6- |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-[2-[2-(4-cyanophenoxy)phenyl]-1,3-dioxoisoindole-5-carbonyl]benzoate |
| SMILES | N#Cc1ccc(Oc2ccccc2N2C(=O)c3ccc(C(=O)c4ccc(C(=O)[O-])cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C29H16N2O6/c30-16-17-5-12-21(13-6-17)37-25-4-2-1-3-24(25)31-27(33)22-14-11-20(15-23(22)28(31)34)26(32)18-7-9-19(10-8-18)29(35)36/h1-15H,(H,35,36)/p-1 |
| InChIKey | CZDFFRGIMKQCLC-UHFFFAOYSA-M |
| XLogP | 3.75 |
| TPSA | 127.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|