C21H13N2O5- — CID 4063318
2-(3-acetamidonaphthalen-2-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4063318) has the molecular formula C21H13N2O5- and a molecular weight of 373.34 g/mol. Its IUPAC name is 2-(3-acetamidonaphthalen-2-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(3-acetamidonaphthalen-2-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4063318 |
| Molecular Formula | C21H13N2O5- |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-(3-acetamidonaphthalen-2-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1cc2ccccc2cc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C21H14N2O5/c1-11(24)22-17-9-12-4-2-3-5-13(12)10-18(17)23-19(25)15-7-6-14(21(27)28)8-16(15)20(23)26/h2-10H,1H3,(H,22,24)(H,27,28)/p-1 |
| InChIKey | QDAMBXGYACXLJN-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|