C11H11N2O4- — CID 6922666
3,4-diacetamidobenzoate (PubChem CID 6922666) has the molecular formula C11H11N2O4- and a molecular weight of 235.22 g/mol. Its IUPAC name is 3,4-diacetamidobenzoate.
| Compound Name | 3,4-diacetamidobenzoate |
|---|---|
| PubChem CID | 6922666 |
| Molecular Formula | C11H11N2O4- |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3,4-diacetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)[O-])cc1NC(C)=O |
| InChI | InChI=1S/C11H12N2O4/c1-6(14)12-9-4-3-8(11(16)17)5-10(9)13-7(2)15/h3-5H,1-2H3,(H,12,14)(H,13,15)(H,16,17)/p-1 |
| InChIKey | GHTLCMPYQOFKCS-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |