C25H35N2O4- — CID 7309256
3,4-bis(3-cyclohexylpropanoylamino)benzoate (PubChem CID 7309256) has the molecular formula C25H35N2O4- and a molecular weight of 427.57 g/mol. Its IUPAC name is 3,4-bis(3-cyclohexylpropanoylamino)benzoate.
| Compound Name | 3,4-bis(3-cyclohexylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 7309256 |
| Molecular Formula | C25H35N2O4- |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 3,4-bis(3-cyclohexylpropanoylamino)benzoate |
| SMILES | O=C(CCC1CCCCC1)Nc1ccc(C(=O)[O-])cc1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C25H36N2O4/c28-23(15-11-18-7-3-1-4-8-18)26-21-14-13-20(25(30)31)17-22(21)27-24(29)16-12-19-9-5-2-6-10-19/h13-14,17-19H,1-12,15-16H2,(H,26,28)(H,27,29)(H,30,31)/p-1 |
| InChIKey | CZSYNOZCOCIWTP-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |