C18H26N2O2 — CID 131913766
N-(2-acetamido-5-methylphenyl)-3-cyclohexylpropanamide (PubChem CID 131913766) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(2-acetamido-5-methylphenyl)-3-cyclohexylpropanamide.
| Compound Name | N-(2-acetamido-5-methylphenyl)-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 131913766 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(2-acetamido-5-methylphenyl)-3-cyclohexylpropanamide |
| SMILES | CC(=O)Nc1ccc(C)cc1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C18H26N2O2/c1-13-8-10-16(19-14(2)21)17(12-13)20-18(22)11-9-15-6-4-3-5-7-15/h8,10,12,15H,3-7,9,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | QTBHRPXUNINBTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |