C17H24BrNO — CID 957346
N-(4-bromo-2,3-dimethylphenyl)-3-cyclohexylpropanamide (PubChem CID 957346) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is N-(4-bromo-2,3-dimethylphenyl)-3-cyclohexylpropanamide.
| Compound Name | N-(4-bromo-2,3-dimethylphenyl)-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 957346 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(4-bromo-2,3-dimethylphenyl)-3-cyclohexylpropanamide |
| SMILES | Cc1c(Br)ccc(NC(=O)CCC2CCCCC2)c1C |
| InChI | InChI=1S/C17H24BrNO/c1-12-13(2)16(10-9-15(12)18)19-17(20)11-8-14-6-4-3-5-7-14/h9-10,14H,3-8,11H2,1-2H3,(H,19,20) |
| InChIKey | DVLWGYYZPMZUJJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |