C10H11Br2NO — CID 46779177
2-bromo-N-(4-bromo-2,3-dimethylphenyl)acetamide (PubChem CID 46779177) has the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. Its IUPAC name is 2-bromo-N-(4-bromo-2,3-dimethylphenyl)acetamide.
| Compound Name | 2-bromo-N-(4-bromo-2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 46779177 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 2-bromo-N-(4-bromo-2,3-dimethylphenyl)acetamide |
| SMILES | Cc1c(Br)ccc(NC(=O)CBr)c1C |
| InChI | InChI=1S/C10H11Br2NO/c1-6-7(2)9(4-3-8(6)12)13-10(14)5-11/h3-4H,5H2,1-2H3,(H,13,14) |
| InChIKey | NWUCMRKGFNXJQK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|