C9H8BrF3N2O — CID 166140871
2-bromo-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]acetamide (PubChem CID 166140871) has the molecular formula C9H8BrF3N2O and a molecular weight of 297.07 g/mol. Its IUPAC name is 2-bromo-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]acetamide.
| Compound Name | 2-bromo-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166140871 |
| Molecular Formula | C9H8BrF3N2O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2-bromo-N-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]acetamide |
| SMILES | Cc1nc(C(F)(F)F)ccc1NC(=O)CBr |
| InChI | InChI=1S/C9H8BrF3N2O/c1-5-6(15-8(16)4-10)2-3-7(14-5)9(11,12)13/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | BCBUOFFCHWLHOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|