C9H8F3NO — CID 2782900
1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 2782900) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is 1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 2782900 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(C(F)(F)F)nc1C |
| InChI | InChI=1S/C9H8F3NO/c1-5-7(6(2)14)3-4-8(13-5)9(10,11)12/h3-4H,1-2H3 |
| InChIKey | SLRPZQQYFZSWBO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |