C16H12ClF3N2O2 — CID 69235352
N-(3-acetyl-4-chlorophenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69235352) has the molecular formula C16H12ClF3N2O2 and a molecular weight of 356.73 g/mol. Its IUPAC name is N-(3-acetyl-4-chlorophenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(3-acetyl-4-chlorophenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69235352 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-(3-acetyl-4-chlorophenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)nc2C)ccc1Cl |
| InChI | InChI=1S/C16H12ClF3N2O2/c1-8-11(4-6-14(21-8)16(18,19)20)15(24)22-10-3-5-13(17)12(7-10)9(2)23/h3-7H,1-2H3,(H,22,24) |
| InChIKey | FUPPOXRTOHIKIW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |