C10H12F3N3O — CID 119382029
N-(2-aminoethyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 119382029) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119382029 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(2-aminoethyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)NCCN |
| InChI | InChI=1S/C10H12F3N3O/c1-6-7(9(17)15-5-4-14)2-3-8(16-6)10(11,12)13/h2-3H,4-5,14H2,1H3,(H,15,17) |
| InChIKey | OJALWKUPEKPCEY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |