C14H19F3N2O2 — CID 69437945
2-methyl-N-(3-propoxypropyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69437945) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-methyl-N-(3-propoxypropyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-(3-propoxypropyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69437945 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-methyl-N-(3-propoxypropyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCCNC(=O)c1ccc(C(F)(F)F)nc1C |
| InChI | InChI=1S/C14H19F3N2O2/c1-3-8-21-9-4-7-18-13(20)11-5-6-12(14(15,16)17)19-10(11)2/h5-6H,3-4,7-9H2,1-2H3,(H,18,20) |
| InChIKey | MAZICKIRGQBMNC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|