C16H11F6N3O2 — CID 2795935
2-methyl-6-(trifluoromethyl)-N'-[4-(trifluoromethyl)benzoyl]pyridine-3-carbohydrazide (PubChem CID 2795935) has the molecular formula C16H11F6N3O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)-N'-[4-(trifluoromethyl)benzoyl]pyridine-3-carbohydrazide.
| Compound Name | 2-methyl-6-(trifluoromethyl)-N'-[4-(trifluoromethyl)benzoyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2795935 |
| Molecular Formula | C16H11F6N3O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)-N'-[4-(trifluoromethyl)benzoyl]pyridine-3-carbohydrazide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6N3O2/c1-8-11(6-7-12(23-8)16(20,21)22)14(27)25-24-13(26)9-2-4-10(5-3-9)15(17,18)19/h2-7H,1H3,(H,24,26)(H,25,27) |
| InChIKey | ZALXAESFEBJFIR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|