C12H13F3N2O3 — CID 119187886
2-methyl-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]propanoic acid (PubChem CID 119187886) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-methyl-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119187886 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-methyl-2-[[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]amino]propanoic acid |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H13F3N2O3/c1-6-7(4-5-8(16-6)12(13,14)15)9(18)17-11(2,3)10(19)20/h4-5H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | BKJXUHICTAJHEK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |