C18H19F3N2O — CID 31890720
N-(2-tert-butylphenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 31890720) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 31890720 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C18H19F3N2O/c1-11-12(9-10-15(22-11)18(19,20)21)16(24)23-14-8-6-5-7-13(14)17(2,3)4/h5-10H,1-4H3,(H,23,24) |
| InChIKey | ZMMJJPLIBJPUNB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |