C9H9Br2NO — CID 131862600
N-(3,4-dibromo-2-methylphenyl)acetamide (PubChem CID 131862600) has the molecular formula C9H9Br2NO and a molecular weight of 306.99 g/mol. Its IUPAC name is N-(3,4-dibromo-2-methylphenyl)acetamide.
| Compound Name | N-(3,4-dibromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 131862600 |
| Molecular Formula | C9H9Br2NO |
| Molecular Weight | 306.99 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | N-(3,4-dibromo-2-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(Br)c(Br)c1C |
| InChI | InChI=1S/C9H9Br2NO/c1-5-8(12-6(2)13)4-3-7(10)9(5)11/h3-4H,1-2H3,(H,12,13) |
| InChIKey | RISJIAGFBXOVNA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.99 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |