C10H12N2O3 — CID 2931975
N-(2,3-dimethyl-4-nitrophenyl)acetamide (PubChem CID 2931975) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(2,3-dimethyl-4-nitrophenyl)acetamide.
| Compound Name | N-(2,3-dimethyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2931975 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(2,3-dimethyl-4-nitrophenyl)acetamide |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])c(C)c1C |
| InChI | InChI=1S/C10H12N2O3/c1-6-7(2)10(12(14)15)5-4-9(6)11-8(3)13/h4-5H,1-3H3,(H,11,13) |
| InChIKey | OLUQCHSXHDYOTM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|