C18H12N4O8 — CID 5485377
N-(8-acetamido-4,5-dinitro-9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 5485377) has the molecular formula C18H12N4O8 and a molecular weight of 412.31 g/mol. Its IUPAC name is N-(8-acetamido-4,5-dinitro-9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | N-(8-acetamido-4,5-dinitro-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 5485377 |
| Molecular Formula | C18H12N4O8 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-(8-acetamido-4,5-dinitro-9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])c2c1C(=O)c1c(NC(C)=O)ccc([N+](=O)[O-])c1C2=O |
| InChI | InChI=1S/C18H12N4O8/c1-7(23)19-9-3-5-11(21(27)28)15-13(9)17(25)14-10(20-8(2)24)4-6-12(22(29)30)16(14)18(15)26/h3-6H,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | QZNQEOQENXBFPL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|