C14H6CuN2O8 — CID 174738241
copper;1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione (PubChem CID 174738241) has the molecular formula C14H6CuN2O8 and a molecular weight of 393.75 g/mol. Its IUPAC name is copper;1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione.
| Compound Name | copper;1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 174738241 |
| Molecular Formula | C14H6CuN2O8 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | copper;1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c([N+](=O)[O-])ccc(O)c21.[Cu] |
| InChI | InChI=1S/C14H6N2O8.Cu/c17-7-3-1-5(15(21)22)9-11(7)14(20)12-8(18)4-2-6(16(23)24)10(12)13(9)19;/h1-4,17-18H; |
| InChIKey | RFCMSPQGSLFCEL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|