C21H11F3N2O6 — CID 18970575
1,2,4-trifluoro-5,8-dihydroxy-3-(2-methyl-6-nitroanilino)anthracene-9,10-dione (PubChem CID 18970575) has the molecular formula C21H11F3N2O6 and a molecular weight of 444.32 g/mol. Its IUPAC name is 1,2,4-trifluoro-5,8-dihydroxy-3-(2-methyl-6-nitroanilino)anthracene-9,10-dione.
| Compound Name | 1,2,4-trifluoro-5,8-dihydroxy-3-(2-methyl-6-nitroanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 18970575 |
| Molecular Formula | C21H11F3N2O6 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1,2,4-trifluoro-5,8-dihydroxy-3-(2-methyl-6-nitroanilino)anthracene-9,10-dione |
| SMILES | Cc1cccc([N+](=O)[O-])c1Nc1c(F)c(F)c2c(c1F)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C21H11F3N2O6/c1-7-3-2-4-8(26(31)32)18(7)25-19-16(23)14-13(15(22)17(19)24)20(29)11-9(27)5-6-10(28)12(11)21(14)30/h2-6,25,27-28H,1H3 |
| InChIKey | QTMRUUPWOLLXJJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|