C16H10F3NO4 — CID 18970696
2-(ethylamino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 18970696) has the molecular formula C16H10F3NO4 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-(ethylamino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-(ethylamino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970696 |
| Molecular Formula | C16H10F3NO4 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-(ethylamino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CCNc1c(F)c(F)c2c(c1F)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C16H10F3NO4/c1-2-20-14-12(18)10-9(11(17)13(14)19)15(23)7-5(21)3-4-6(22)8(7)16(10)24/h3-4,20-22H,2H2,1H3 |
| InChIKey | FRDHDIOJTXPGGV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|