C30H42N2O4 — CID 23062166
1,4-bis(2-ethylhexylamino)-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 23062166) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexylamino)-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1,4-bis(2-ethylhexylamino)-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 23062166 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 1,4-bis(2-ethylhexylamino)-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCC(CC)CNc1ccc(NCC(CC)CCCC)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C30H42N2O4/c1-5-9-11-19(7-3)17-31-21-13-14-22(32-18-20(8-4)12-10-6-2)26-25(21)29(35)27-23(33)15-16-24(34)28(27)30(26)36/h13-16,19-20,31-34H,5-12,17-18H2,1-4H3 |
| InChIKey | HJPZLFBZKDXVOA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|