C22H14F3NO4 — CID 18970553
2-(2,6-dimethylanilino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 18970553) has the molecular formula C22H14F3NO4 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2-(2,6-dimethylanilino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-(2,6-dimethylanilino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970553 |
| Molecular Formula | C22H14F3NO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-(2,6-dimethylanilino)-1,3,4-trifluoro-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | Cc1cccc(C)c1Nc1c(F)c(F)c2c(c1F)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C22H14F3NO4/c1-8-4-3-5-9(2)19(8)26-20-17(24)15-14(16(23)18(20)25)21(29)12-10(27)6-7-11(28)13(12)22(15)30/h3-7,26-28H,1-2H3 |
| InChIKey | YAQXSXHMGAEPLP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|