C46H58FN3O4 — CID 18970674
1,2-bis[2,6-di(propan-2-yl)anilino]-4-fluoro-5,8-dihydroxy-3-(octylamino)anthracene-9,10-dione (PubChem CID 18970674) has the molecular formula C46H58FN3O4 and a molecular weight of 735.99 g/mol. Its IUPAC name is 1,2-bis[2,6-di(propan-2-yl)anilino]-4-fluoro-5,8-dihydroxy-3-(octylamino)anthracene-9,10-dione.
| Compound Name | 1,2-bis[2,6-di(propan-2-yl)anilino]-4-fluoro-5,8-dihydroxy-3-(octylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 18970674 |
| Molecular Formula | C46H58FN3O4 |
| Molecular Weight | 735.99 g/mol |
| Exact Mass | 735.44 |
| IUPAC Name | 1,2-bis[2,6-di(propan-2-yl)anilino]-4-fluoro-5,8-dihydroxy-3-(octylamino)anthracene-9,10-dione |
| SMILES | CCCCCCCCNc1c(F)c2c(c(Nc3c(C(C)C)cccc3C(C)C)c1Nc1c(C(C)C)cccc1C(C)C)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C46H58FN3O4/c1-10-11-12-13-14-15-24-48-43-39(47)37-38(46(54)36-34(52)23-22-33(51)35(36)45(37)53)42(49-40-29(25(2)3)18-16-19-30(40)26(4)5)44(43)50-41-31(27(6)7)20-17-21-32(41)28(8)9/h16-23,25-28,48-52H,10-15,24H2,1-9H3 |
| InChIKey | ITMZFYYJDCQWBO-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.99 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|